Products 34322-51-5
CAS 34322-51-5 appears in our catalog under these names: 6–(Dimethylamino)naphthalene–2–sulfonic acid, 6-(Dimethylamino)naphthalene-2-sulfonic acid 97%, 6-(Dimethylamino)naphthalene-2-sulfonic acid, 97%, 97%, 6-(DIMETHYLAMINO)NAPHTHALENE-2-SULFONIC ACID, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
6-(dimethylamino)naphthalene-2-sulfonic acid (CAS 34322-51-5) is a chemical compound with the molecular formula C12H13NO3S and a molecular weight of 251.30 g/mol. IUPAC name: 6-(dimethylamino)naphthalene-2-sulfonic acid. InChIKey: MLWGJWPCYRPPMQ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | 6-(dimethylamino)naphthalene-2-sulfonic acid |
| InChIKey | MLWGJWPCYRPPMQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C=C(C=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)