CAS 3435-23-2 appears in our catalog under these names: 4-Phenylpyrimidin-5-amine, 98%, 4-Phenylpyrimidin-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-phenylpyrimidin-5-amine (CAS 3435-23-2) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 4-phenylpyrimidin-5-amine. InChIKey: DQFRFPWGQVAOMT-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 4-phenylpyrimidin-5-amine |
| InChIKey | DQFRFPWGQVAOMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=NC=C2N |
Computed by PubChem (NCBI)