Products 34373-09-6
CAS 34373-09-6 appears in our catalog under these names: 1-(4-Aminophenyl)pyrrolidine-2,5-dione, 95%, 95%, 1-(4-Aminophenyl)pyrrolidine-2,5-dione, 1-(4-Aminophenyl)pyrrolidine-2,5-dione, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(4-aminophenyl)pyrrolidine-2,5-dione (CAS 34373-09-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 1-(4-aminophenyl)pyrrolidine-2,5-dione. InChIKey: ZEPJTGNICKTBTQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 1-(4-aminophenyl)pyrrolidine-2,5-dione |
| InChIKey | ZEPJTGNICKTBTQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)