CAS 34477-50-4 is the registry number for 2-{3-Oxo-2H,3H,5H,6H-imidazo(2,1-b)(1,3)thiazol-2-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-oxo-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid (CAS 34477-50-4) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: 2-(3-oxo-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid. InChIKey: BMOQXPGFAUYFBL-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 2-(3-oxo-5,6-dihydroimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid |
| InChIKey | BMOQXPGFAUYFBL-UHFFFAOYSA-N |
| SMILES | C1CN2C(=O)C(SC2=N1)CC(=O)O |
Computed by PubChem (NCBI)