CAS 345631-78-9 is the registry number for 3-(Pyridin-3-yl)-1,2,4-oxadiazole-5-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-pyridin-3-yl-2H-1,2,4-oxadiazole-5-thione (CAS 345631-78-9) is a chemical compound with the molecular formula C7H5N3OS and a molecular weight of 179.20 g/mol. IUPAC name: 3-pyridin-3-yl-2H-1,2,4-oxadiazole-5-thione. InChIKey: FYNBWTWYAPOXGP-UHFFFAOYSA-N.
| Molecular formula | C7H5N3OS |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 3-pyridin-3-yl-2H-1,2,4-oxadiazole-5-thione |
| InChIKey | FYNBWTWYAPOXGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC(=S)ON2 |
Computed by PubChem (NCBI)