Products 34588-30-2
CAS 34588-30-2 is the registry number for 4,4''-Diamino-[1,1':4',1''-terphenyl]-2',5'-diol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,5-bis(4-aminophenyl)benzene-1,4-diol (CAS 34588-30-2) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: 2,5-bis(4-aminophenyl)benzene-1,4-diol. InChIKey: FLZCTTSNYITYAC-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 2,5-bis(4-aminophenyl)benzene-1,4-diol |
| InChIKey | FLZCTTSNYITYAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2O)C3=CC=C(C=C3)N)O)N |
Computed by PubChem (NCBI)