Products 34633-67-5
CAS 34633-67-5 is the registry number for 5-Chloro-4-methyl-2-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-chloro-4-methyl-2-nitrobenzoic acid (CAS 34633-67-5) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 5-chloro-4-methyl-2-nitrobenzoic acid. InChIKey: AFGAORZJNYXGEV-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 5-chloro-4-methyl-2-nitrobenzoic acid |
| InChIKey | AFGAORZJNYXGEV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
5-chloro-4-methyl-2-nitrobenzoic acid