CAS 34649-02-0 is the registry number for 2-Amino-5-chloro-4-nitrobenzoic Acid. Offered by: TRC. Available pack sizes: 1g.
2-amino-5-chloro-4-nitrobenzoic acid (CAS 34649-02-0) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: 2-amino-5-chloro-4-nitrobenzoic acid. InChIKey: ORWYNMNDNSUAGR-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O4 |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | 2-amino-5-chloro-4-nitrobenzoic acid |
| InChIKey | ORWYNMNDNSUAGR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)[N+](=O)[O-])N)C(=O)O |
Computed by PubChem (NCBI)