Products 3465-61-0
CAS 3465-61-0 is the registry number for 3-(5-Phenyl-furan-2-yl)-propionic acid. Offered by: Biosynth. Available pack sizes: 0,05g, 0,1g, 0,25g, 0,5g, 1g.
3-(5-phenylfuran-2-yl)propanoic acid (CAS 3465-61-0) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 3-(5-phenylfuran-2-yl)propanoic acid. InChIKey: JKBUDDSGMWGQDN-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 3-(5-phenylfuran-2-yl)propanoic acid |
| InChIKey | JKBUDDSGMWGQDN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(O2)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(5-phenylfuran-2-yl)propanoic acid, 3-(5-Phenyl-2-furyl)propanoic acid, 3-(5-Phenyl-furan-2-yl)-propionic acid, 5-Phenyl-2-furanpropanoic acid, 3-(5-phenylfuran-2-yl)propanoic Aci, Oprea1_797469, JKBUDDSGMWGQDN-UHFFFAOYSA-N, 3-(5-phenylfuran-2-yl)propanoicacid, 3-(5-Phenyl-2-furyl)propanoic acid #, Propanoic acid, 3-(5-phenyl-2-furyl)-