Products 34718-92-8
CAS 34718-92-8 is the registry number for 5'-Amino-5'-deoxyuridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,3R,4S,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (CAS 34718-92-8) is a chemical compound with the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. IUPAC name: 1-[(2R,3R,4S,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione. InChIKey: DJYTWLADTBMTBF-XVFCMESISA-N.
| Molecular formula | C9H13N3O5 |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | DJYTWLADTBMTBF-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CN)O)O |
Computed by PubChem (NCBI)