CAS 349119-38-6 is the registry number for Acetic acid, 2-((3-chloro-4-methylphenyl)amino)-2-oxo-, ethyl ester, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
Ethyl 2-(3-chloro-4-methylanilino)-2-oxoacetate (CAS 349119-38-6) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: ethyl 2-(3-chloro-4-methylanilino)-2-oxoacetate. InChIKey: JKPZMHQRKVAICD-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | ethyl 2-(3-chloro-4-methylanilino)-2-oxoacetate |
| InChIKey | JKPZMHQRKVAICD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=CC(=C(C=C1)C)Cl |
Computed by PubChem (NCBI)