Products 34915-64-5
CAS 34915-64-5 appears in our catalog under these names: 2–(2–Chloro–3–nitrophenyl)acetic acid, 2-(2-Chloro-3-nitrophenyl)acetic acid 97%, 2-(2-Chloro-3-nitrophenyl)acetic acid, 97%, 97%, 2-(2-CHLORO-3-NITROPHENYL)ACETIC ACID, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
2-(2-chloro-3-nitrophenyl)acetic acid (CAS 34915-64-5) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(2-chloro-3-nitrophenyl)acetic acid. InChIKey: YNAGRJPZFRHHOQ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(2-chloro-3-nitrophenyl)acetic acid |
| InChIKey | YNAGRJPZFRHHOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)CC(=O)O |
Computed by PubChem (NCBI)