CAS 34921-60-3 appears in our catalog under these names: 5-Bromo-7-ethylindoline-2,3-dione, 95%, 5–Bromo–7–ethylindoline–2,3–dione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
5-bromo-7-ethyl-1H-indole-2,3-dione (CAS 34921-60-3) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 5-bromo-7-ethyl-1H-indole-2,3-dione. InChIKey: CTGQHGOEVARVKX-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 5-bromo-7-ethyl-1H-indole-2,3-dione |
| InChIKey | CTGQHGOEVARVKX-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC(=C1)Br)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)