Products 35026-10-9
CAS 35026-10-9 appears in our catalog under these names: Methyldopa EP Impurity B HCl, O,a-Dimethyl-L-tyrosine Hydrochloride, >95% (HPLC), (S)-2-Amino-3-(4-methoxyphenyl)-2-methylpropanoic acid hydrochloride, 98%, 98%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 100mg, 25mg, 250mg, 1g.
(2S)-2-amino-3-(4-methoxyphenyl)-2-methylpropanoic acid;hydrochloride (CAS 35026-10-9) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: (2S)-2-amino-3-(4-methoxyphenyl)-2-methylpropanoic acid;hydrochloride. InChIKey: SGYWMGBCHWKZDJ-MERQFXBCSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-methoxyphenyl)-2-methylpropanoic acid;hydrochloride |
| InChIKey | SGYWMGBCHWKZDJ-MERQFXBCSA-N |
| SMILES | C[C@](CC1=CC=C(C=C1)OC)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
O,alpha-Dimethyl-L-tyrosine Hydrochloride, L-Tyrosine, O,alpha-dimethyl-, hydrochloride, (2S)-2-amino-3-(4-methoxyphenyl)-2-methylpropanoic acid;hydrochloride, (S)-2-Amino-3-(4-methoxyphenyl)-2-methylpropanoic acid hydrochloride, O,?-Dimethyl-L-tyrosine Hydrochloride, Methyldopa EP Impurity B HCl, O,.ALPHA.-DIMETHYL-L-TYROSINE HYDROCHLORIDE, L-TYROSINE, O,.ALPHA.-DIMETHYL-, HYDROCHLORIDE