CAS 35051-65-1 is the registry number for methyl (2S)-2-amino-2-phenylpropanoate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl (2S)-2-amino-2-phenylpropanoate;hydrochloride (CAS 35051-65-1) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl (2S)-2-amino-2-phenylpropanoate;hydrochloride. InChIKey: VBBAHSFGHQGGNJ-PPHPATTJSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-phenylpropanoate;hydrochloride |
| InChIKey | VBBAHSFGHQGGNJ-PPHPATTJSA-N |
| SMILES | C[C@](C1=CC=CC=C1)(C(=O)OC)N.Cl |
Computed by PubChem (NCBI)