CAS 350818-59-6 is the registry number for 4-Nitrobiphenyl-d9, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,2,3,4,5-pentadeuterio-6-(2,3,5,6-tetradeuterio-4-nitrophenyl)benzene (CAS 350818-59-6) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 208.26 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(2,3,5,6-tetradeuterio-4-nitrophenyl)benzene. InChIKey: BAJQRLZAPXASRD-LOIXRAQWSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(2,3,5,6-tetradeuterio-4-nitrophenyl)benzene |
| InChIKey | BAJQRLZAPXASRD-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])[N+](=O)[O-])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)