Products 350818-59-6

CAS 350818-59-6 is the registry number for 4-Nitrobiphenyl-d9, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

1,2,3,4,5-pentadeuterio-6-(2,3,5,6-tetradeuterio-4-nitrophenyl)benzene (CAS 350818-59-6) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 208.26 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(2,3,5,6-tetradeuterio-4-nitrophenyl)benzene. InChIKey: BAJQRLZAPXASRD-LOIXRAQWSA-N.

Identity
Molecular formulaC12H9NO2
Molecular weight208.26 g/mol
IUPAC name1,2,3,4,5-pentadeuterio-6-(2,3,5,6-tetradeuterio-4-nitrophenyl)benzene
InChIKeyBAJQRLZAPXASRD-LOIXRAQWSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])[N+](=O)[O-])[2H])[2H])[2H])[2H]

Computed by PubChem (NCBI)

Synonyms: 4-Nitrobiphenyl-d9