CAS 64421-02-9 is the registry number for 2-Nitrobiphenyl-2',3',4',5',6'-d5. Offered by: TRC. Available pack sizes: 50mg, 5mg.
1,2,3,4,5-pentadeuterio-6-(4-nitrophenyl)benzene (CAS 64421-02-9) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 204.24 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(4-nitrophenyl)benzene. InChIKey: BAJQRLZAPXASRD-RALIUCGRSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(4-nitrophenyl)benzene |
| InChIKey | BAJQRLZAPXASRD-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC=C(C=C2)[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)