CAS 35112-27-7 appears in our catalog under these names: Ethyl 2,5–Dichlorobenzoate, 2,5-Dichlorobenzoic acid ethyl ester, Ethyl 2,5-Dichlorobenzoate, >98.0%(GC), Ethyl 2,5-dichlorobenzoate 98%, Ethyl 2,5-dichlorobenzoate, 97%, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 50g, 250g.
Ethyl 2,5-dichlorobenzoate (CAS 35112-27-7) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: ethyl 2,5-dichlorobenzoate. InChIKey: JSZYWIKNIZKJAN-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | ethyl 2,5-dichlorobenzoate |
| InChIKey | JSZYWIKNIZKJAN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)