Products 351367-77-6
CAS 351367-77-6 appears in our catalog under these names: 2-Amino-5-chloro-4-fluorobenzoic acid, 95%, 2-Amino-5-chloro-4-fluoro-benzoic Acid, >95% (HPLC), 2–Amino–5–chloro–4–fluorobenzoic acid, 2-Amino-5-chloro-4-fluorobenzoic acid, Benzoic acid, 2-amino-5-chloro-4-fluoro-, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg, 0,5g, 5g, 10g.
2-amino-5-chloro-4-fluorobenzoic acid (CAS 351367-77-6) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 2-amino-5-chloro-4-fluorobenzoic acid. InChIKey: VTFCXMNTJYSFIR-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 2-amino-5-chloro-4-fluorobenzoic acid |
| InChIKey | VTFCXMNTJYSFIR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)N)C(=O)O |
Computed by PubChem (NCBI)