Products 351493-11-3

CAS 351493-11-3 is the registry number for 1-(5-Chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

1-(5-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylic acid (CAS 351493-11-3) is a chemical compound with the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. IUPAC name: 1-(5-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylic acid. InChIKey: TVIXLMZTSWAKCN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClNO3S
Molecular weight259.71 g/mol
IUPAC name1-(5-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylic acid
InChIKeyTVIXLMZTSWAKCN-UHFFFAOYSA-N
SMILESC1CC(N(C1)C(=O)C2=CC=C(S2)Cl)C(=O)O

Computed by PubChem (NCBI)