CAS 3516-91-4 is the registry number for 2,3,5,6-Tetrafluorophenylacetic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3,5,6-tetrafluorophenyl)acetic acid (CAS 3516-91-4) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(2,3,5,6-tetrafluorophenyl)acetic acid. InChIKey: FEWXCSFHJUKZQP-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(2,3,5,6-tetrafluorophenyl)acetic acid |
| InChIKey | FEWXCSFHJUKZQP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)CC(=O)O)F)F |
Computed by PubChem (NCBI)