CAS 351992-19-3 is the registry number for 4-Bromo-N-ethylphthalimide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-2-ethylisoindole-1,3-dione (CAS 351992-19-3) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 5-bromo-2-ethylisoindole-1,3-dione. InChIKey: ZXCTXIQGCZCRNK-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 5-bromo-2-ethylisoindole-1,3-dione |
| InChIKey | ZXCTXIQGCZCRNK-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)