CAS 35203-49-7 appears in our catalog under these names: N1-Methyl-4-(Trifluoromethyl)Benzene-1,2-Diamine, 98%, 98%, N*1*-Methyl-4-trifluoromethyl-benzene-1,2-diamine, 98%, N1-Methyl-4-(trifluoromethyl)benzene-1,2-diamine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g.
1-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine (CAS 35203-49-7) is a chemical compound with the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. IUPAC name: 1-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine. InChIKey: KWYSQBACVABOFL-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 1-N-methyl-4-(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | KWYSQBACVABOFL-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)