CAS 35207-08-0 is the registry number for N-Carbamoylbenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzenesulfonylurea (CAS 35207-08-0) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: benzenesulfonylurea. InChIKey: GHDLZGOOOLEJKI-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | benzenesulfonylurea |
| InChIKey | GHDLZGOOOLEJKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC(=O)N |
Computed by PubChem (NCBI)