Products 35225-01-5
CAS 35225-01-5 appears in our catalog under these names: 5–(3–Chlorophenyl)–1H–1，2，3–triazole, 5-(3-Chlorophenyl)-1H-1,2,3-triazole 97%, 4-(3-Chlorophenyl)-1H-1,2,3-triazole, 95-<97%, 4-(3-Chlorophenyl)-1H-1,2,3-triazole, ≥97-<99%, 5-(3-Chlorophenyl)-1H-1,2,3-triazole, 97%, 97%. Offered by: GLPBio, Ambeed, Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 2,5g, 5g, 10g, 25g, 50g.
4-(3-chlorophenyl)-2H-triazole (CAS 35225-01-5) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 4-(3-chlorophenyl)-2H-triazole. InChIKey: VLAULFMSWJFSFA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-2H-triazole |
| InChIKey | VLAULFMSWJFSFA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NNN=C2 |
Computed by PubChem (NCBI)