CAS 35227-79-3 appears in our catalog under these names: 3,5-Diacetylanisol, 95%, 3,5–DIacetylanisol, 1,1'-(5-Methoxy-1,3-phenylene)bis(ethan-1-one) 95%, 3,5-DIacetylanisol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g, 100g.
1-(3-acetyl-5-methoxyphenyl)ethanone (CAS 35227-79-3) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 1-(3-acetyl-5-methoxyphenyl)ethanone. InChIKey: MQWOVRDXAJUQFQ-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 1-(3-acetyl-5-methoxyphenyl)ethanone |
| InChIKey | MQWOVRDXAJUQFQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)OC)C(=O)C |
Computed by PubChem (NCBI)