Products 352330-84-8
CAS 352330-84-8 appears in our catalog under these names: 2-(2-Bromophenyl)-5-methyl-1,3,4-oxadiazole, 95%, 2-(2-Bromophenyl)-5-methyl-1,3,4-oxadiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(2-bromophenyl)-5-methyl-1,3,4-oxadiazole (CAS 352330-84-8) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 2-(2-bromophenyl)-5-methyl-1,3,4-oxadiazole. InChIKey: QOMHHFGPICCGLG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 2-(2-bromophenyl)-5-methyl-1,3,4-oxadiazole |
| InChIKey | QOMHHFGPICCGLG-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)