CAS 3524-06-9 is the registry number for 5-Methoxybenzofurazan 3-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
5-methoxy-3-oxido-2,1,3-benzoxadiazol-3-ium (CAS 3524-06-9) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 5-methoxy-3-oxido-2,1,3-benzoxadiazol-3-ium. InChIKey: XCWFKHHSXPIDHN-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 5-methoxy-3-oxido-2,1,3-benzoxadiazol-3-ium |
| InChIKey | XCWFKHHSXPIDHN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=[N+](ON=C2C=C1)[O-] |
Computed by PubChem (NCBI)