Products 352534-81-7
CAS 352534-81-7 appears in our catalog under these names: 3–Butoxyphenylboronic acid, 3-Butoxyphenylboronic Acid (contains varying amounts of Anhydride), 3-Butoxyphenylboronic acid 97%, 3-Butoxyphenylboronic acid, 97%, 97%, 3-Butoxyphenylboronic acid, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
(3-butoxyphenyl)boronic acid (CAS 352534-81-7) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (3-butoxyphenyl)boronic acid. InChIKey: ZTRKYYYDXARQRD-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (3-butoxyphenyl)boronic acid |
| InChIKey | ZTRKYYYDXARQRD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCCCC)(O)O |
Computed by PubChem (NCBI)