CAS 35264-05-2 appears in our catalog under these names: 2–((tert–Butoxycarbonyl)amino)–2–cyclohexylacetic acid, 2-((tert-Butoxycarbonyl)amino)-2-cyclohexylacetic acid, 97.0%, Boc-DL-2-cHex-Gly-OH 97%, N-Boc-2-Cyclohexyl-DL-glycine, 97%, tert-Butoxycarbonylamino-cyclohexyl-acetic acid, 97%. Offered by: GLPBio, MedChemExpress, Ambeed, Fluorochem, Combi-blocks. Available pack sizes: 1g, 100 g, 25 g, 100mg, 5g, 10g, 25g, 100g.
2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 35264-05-2) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: QSUXZIPXYDQFCX-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | QSUXZIPXYDQFCX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1CCCCC1)C(=O)O |
Computed by PubChem (NCBI)