Products 35480-23-0
CAS 35480-23-0 appears in our catalog under these names: Naphthalen-2-ylmethyl acetate, 95%, 2-Naphthylmethyl acetate, 95-<97%, naphthalen–2–ylmethyl acetate, Naphthalen-2-ylmethyl acetate 98%, 2-Naphthylmethyl acetate. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 25g, 50g, 100g, 200g, 300g.
Naphthalen-2-ylmethyl acetate (CAS 35480-23-0) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: naphthalen-2-ylmethyl acetate. InChIKey: HKBNQGIZBGLLAL-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | naphthalen-2-ylmethyl acetate |
| InChIKey | HKBNQGIZBGLLAL-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)