CAS 35480-48-9 is the registry number for 3-(2,2,2-Trifluoroethoxy)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-(2,2,2-trifluoroethoxy)benzoic acid (CAS 35480-48-9) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: VWFMHRHEAZGJBM-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | VWFMHRHEAZGJBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)