CAS 35504-92-8 appears in our catalog under these names: (2E)-3-Methyl-4-oxo-4-phenyl-2-butenoic acid, 95%+, 95%+, (2E)-3-METHYL-4-OXO-4-PHENYLBUT-2-ENOIC ACID, 95%+. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-methyl-4-oxo-4-phenylbut-2-enoic acid (CAS 35504-92-8) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: (E)-3-methyl-4-oxo-4-phenylbut-2-enoic acid. InChIKey: HNHGQBDWKKMPCN-BQYQJAHWSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (E)-3-methyl-4-oxo-4-phenylbut-2-enoic acid |
| InChIKey | HNHGQBDWKKMPCN-BQYQJAHWSA-N |
| SMILES | C/C(=C\C(=O)O)/C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)