Products 35588-39-7
CAS 35588-39-7 is the registry number for 2-Chloro-N-(2-hydroxy-5-nitrophenyl)acetamide. Offered by: Biosynth. Available pack sizes: 2,5g.
2-chloro-N-(2-hydroxy-5-nitrophenyl)acetamide (CAS 35588-39-7) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: 2-chloro-N-(2-hydroxy-5-nitrophenyl)acetamide. InChIKey: OCOPCFMOIXUZCA-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | 2-chloro-N-(2-hydroxy-5-nitrophenyl)acetamide |
| InChIKey | OCOPCFMOIXUZCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])NC(=O)CCl)O |
Computed by PubChem (NCBI)