Products 35615-97-5
CAS 35615-97-5 appears in our catalog under these names: Methyl 4-Bromo-1-naphthoate, 97%, 97%, Methyl 4-bromonaphthalene-1-carboxylate 97%, Methyl 4–Bromo–1–naphthoate, Methyl 4-bromo-1-naphthoate, 95%. Offered by: Chemat, Ambeed, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
Methyl 4-bromonaphthalene-1-carboxylate (CAS 35615-97-5) is a chemical compound with the molecular formula C12H9BrO2 and a molecular weight of 265.10 g/mol. IUPAC name: methyl 4-bromonaphthalene-1-carboxylate. InChIKey: NSWYFJWAOXYZDF-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO2 |
|---|---|
| Molecular weight | 265.10 g/mol |
| IUPAC name | methyl 4-bromonaphthalene-1-carboxylate |
| InChIKey | NSWYFJWAOXYZDF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C2=CC=CC=C21)Br |
Computed by PubChem (NCBI)