CAS 59866-97-6 appears in our catalog under these names: Methyl 5-bromonaphthalene-1-carboxylate, 97%, Methyl 5-bromo-1-naphthoate 98%, Methyl 5-bromo-1-naphthoate, 98%, 98%, Methyl 5-bromo-1-naphthoate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg.
Methyl 5-bromonaphthalene-1-carboxylate (CAS 59866-97-6) is a chemical compound with the molecular formula C12H9BrO2 and a molecular weight of 265.10 g/mol. IUPAC name: methyl 5-bromonaphthalene-1-carboxylate. InChIKey: MGAHYBCONLQGDK-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO2 |
|---|---|
| Molecular weight | 265.10 g/mol |
| IUPAC name | methyl 5-bromonaphthalene-1-carboxylate |
| InChIKey | MGAHYBCONLQGDK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1C=CC=C2Br |
Computed by PubChem (NCBI)