CAS 359810-48-3 is the registry number for 5-(2-Bromo-4-methylphenyl)-2-furaldehyde, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(2-bromo-4-methylphenyl)furan-2-carbaldehyde (CAS 359810-48-3) is a chemical compound with the molecular formula C12H9BrO2 and a molecular weight of 265.10 g/mol. IUPAC name: 5-(2-bromo-4-methylphenyl)furan-2-carbaldehyde. InChIKey: JRJUEVPOZMWWNK-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO2 |
|---|---|
| Molecular weight | 265.10 g/mol |
| IUPAC name | 5-(2-bromo-4-methylphenyl)furan-2-carbaldehyde |
| InChIKey | JRJUEVPOZMWWNK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC=C(O2)C=O)Br |
Computed by PubChem (NCBI)