CAS 67029-82-7 appears in our catalog under these names: 2-Bromo-1-(1-hydroxynaphthalen-2-yl)ethanone, 98%, 2-Bromo-1-(1-hydroxynaphthalen-2-yl)ethanone, 95+%, 2–Bromo–1–(1–hydroxynaphthalen–2–yl)ethanone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g.
2-bromo-1-(1-hydroxynaphthalen-2-yl)ethanone (CAS 67029-82-7) is a chemical compound with the molecular formula C12H9BrO2 and a molecular weight of 265.10 g/mol. IUPAC name: 2-bromo-1-(1-hydroxynaphthalen-2-yl)ethanone. InChIKey: ADLPBUIQLXKAAC-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO2 |
|---|---|
| Molecular weight | 265.10 g/mol |
| IUPAC name | 2-bromo-1-(1-hydroxynaphthalen-2-yl)ethanone |
| InChIKey | ADLPBUIQLXKAAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2O)C(=O)CBr |
Computed by PubChem (NCBI)