Products 860650-56-2

CAS 860650-56-2 is the registry number for 5-Bromo-6-methyl-2-naphthoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-bromo-6-methylnaphthalene-2-carboxylic acid (CAS 860650-56-2) is a chemical compound with the molecular formula C12H9BrO2 and a molecular weight of 265.10 g/mol. IUPAC name: 5-bromo-6-methylnaphthalene-2-carboxylic acid. InChIKey: YXGJPRXNIBTGGB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9BrO2
Molecular weight265.10 g/mol
IUPAC name5-bromo-6-methylnaphthalene-2-carboxylic acid
InChIKeyYXGJPRXNIBTGGB-UHFFFAOYSA-N
SMILESCC1=C(C2=C(C=C1)C=C(C=C2)C(=O)O)Br

Computed by PubChem (NCBI)