CAS 35675-46-8 is the registry number for 3-Methyl-4-nitrobenzoyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-methyl-4-nitrobenzoyl chloride (CAS 35675-46-8) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 3-methyl-4-nitrobenzoyl chloride. InChIKey: DUEGOHNPUBPUIV-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 3-methyl-4-nitrobenzoyl chloride |
| InChIKey | DUEGOHNPUBPUIV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)