CAS 35697-15-5 is the registry number for Nadolol Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-5-(oxiran-2-ylmethoxy)-1,2,3,4-tetrahydronaphthalene-2,3-diol (CAS 35697-15-5) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: (2S,3R)-5-(oxiran-2-ylmethoxy)-1,2,3,4-tetrahydronaphthalene-2,3-diol. InChIKey: OAFYUCDEFSNRJA-CLGJWYQZSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (2S,3R)-5-(oxiran-2-ylmethoxy)-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| InChIKey | OAFYUCDEFSNRJA-CLGJWYQZSA-N |
| SMILES | C1[C@@H]([C@@H](CC2=C1C=CC=C2OCC3CO3)O)O |
Computed by PubChem (NCBI)