CAS 35715-85-6 appears in our catalog under these names: 2-(6-Chloro-1H-indazol-3-yl)acetic acid, 95+%, 2–(6–chloro–1H–indazol–3–yl)aceticacid. Offered by: AmBeed, GLPBio. Available pack sizes: 1g.
2-(6-chloro-2H-indazol-3-yl)acetic acid (CAS 35715-85-6) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 2-(6-chloro-2H-indazol-3-yl)acetic acid. InChIKey: PSEDUPQQLIMVBQ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 2-(6-chloro-2H-indazol-3-yl)acetic acid |
| InChIKey | PSEDUPQQLIMVBQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C=C1Cl)CC(=O)O |
Computed by PubChem (NCBI)