CAS 35793-73-8 appears in our catalog under these names: (R)–5–(Benzyloxy)–2–((tert–butoxycarbonyl)amino)–5–oxopentanoic acid, Boc-D-Glu(Bzl)-OH, N-Boc-D-glutamic acid 5-benzyl ester, 98% , Boc-D-Glu(OBzl)-OH, Boc-D-Glu(OBzl)-OH, 96%, 96%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 100g, 10g, 25g, 5g, 250g, 1g, 250mg.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid (CAS 35793-73-8) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: AJDUMMXHVCMISJ-CYBMUJFWSA-N.
| Molecular formula | C17H23NO6 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | AJDUMMXHVCMISJ-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)