Products 35854-94-5
CAS 35854-94-5 is the registry number for PBDE 155. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
1,3,5-tribromo-2-(2,4,6-tribromophenoxy)benzene (CAS 35854-94-5) is a chemical compound with the molecular formula C12H4Br6O and a molecular weight of 643.6 g/mol. IUPAC name: 1,3,5-tribromo-2-(2,4,6-tribromophenoxy)benzene. InChIKey: HRSCBOSGEKXXSI-UHFFFAOYSA-N.
| Molecular formula | C12H4Br6O |
|---|---|
| Molecular weight | 643.6 g/mol |
| IUPAC name | 1,3,5-tribromo-2-(2,4,6-tribromophenoxy)benzene |
| InChIKey | HRSCBOSGEKXXSI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)OC2=C(C=C(C=C2Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
1,2,5-tribromo-3-(2,4,6-tribromophenoxy)benzene, Hexabromodiphenyl ether, Hexabromodiphenyl oxide, Hexabromophenoxybenzene, 2,2',4,4',6,6'-hexabromodiphenyl ether, Hexabromodiphenyl ether 155, Bis(2,4,6-tribromophenyl) ether, 1,3,5-tribromo-2-(2,4,6-tribromophenoxy)benzene, Benzene, 1,3,5-tribromo-2-(2,4,6-tribromophenoxy)-, 2,4,6,2',4',6'-Hexabromodiphenyl ether