Products 358730-88-8
CAS 358730-88-8 appears in our catalog under these names: Diisobutyl Phthalate-d4, >95% (HPLC), Di-iso-butyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Phthalic acid, bis-isobutyl ester D4, DI-ISO-BUTYL-PHTHALATE -D4, OEKANAL, DIISOBUTYL PHTHALATE-3,4,5,6-D4. Offered by: TRC, CDN, Dr. Ehrenstorfer, Sigma-Aldrich, HPC Standards. Available pack sizes: 100mg, 10mg, 25mg, 0,25g, 0,1g, 1x25mg.
Bis(2-methylpropyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 358730-88-8) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 282.37 g/mol. IUPAC name: bis(2-methylpropyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: MGWAVDBGNNKXQV-KDWZCNHSSA-N.
| Molecular formula | C16H22O4 |
|---|---|
| Molecular weight | 282.37 g/mol |
| IUPAC name | bis(2-methylpropyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | MGWAVDBGNNKXQV-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC(C)C)C(=O)OCC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Bis(2-methylpropyl) (~2~H_4_)benzene-1,2-dicarboxylate, Diisobutyl Phthalate-d4, Diisobutyl phthalate-3,4,5,6-d4, Phthalic acid, bis-isobutyl ester D4, bis(2-methylpropyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate, orb2299608, orb3025195, Diisobutyl phthalate-3,4,5,6-d?, Diisobutyl phthalate-3,4,5,6-d4, 98 atom % D, Diisobutyl phthalate-3,4,5,6-d4, analytical standard