Products 358731-15-4
CAS 358731-15-4 appears in our catalog under these names: Di-n-butyl Phthalate-d22, >95% (HPLC), Di-n-butyl Phthalate-d22, 99 atom % D, min 98% Chemical Purity, Dibutyl phthalate-d22, 99%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 10 mg, 5 mg, 1 mg.
Bis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 358731-15-4) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 300.48 g/mol. IUPAC name: bis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: DOIRQSBPFJWKBE-ICZXYYBKSA-N.
| Molecular formula | C16H22O4 |
|---|---|
| Molecular weight | 300.48 g/mol |
| IUPAC name | bis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | DOIRQSBPFJWKBE-ICZXYYBKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])C(=O)OC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)