Products 358731-29-0
CAS 358731-29-0 appears in our catalog under these names: Di-n-propyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Di-n-propyl Phthalate-d4, >95% (GC), Phthalic acid, bis-propyl ester D4, Dipropyl phthalate-d4, D4-Dipropyl phthalate. Offered by: CDN, TRC, Dr. Ehrenstorfer, MedChemExpress, HPC Standards. Available pack sizes: 0,1g, 0,05g, 100mg, 10mg, 1 mg, 5 mg, 1x10mg.
Dipropyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 358731-29-0) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 254.31 g/mol. IUPAC name: dipropyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: MQHNKCZKNAJROC-KDWZCNHSSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | dipropyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | MQHNKCZKNAJROC-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCC)C(=O)OCCC)[2H])[2H] |
Computed by PubChem (NCBI)