CAS 35888-99-4 appears in our catalog under these names: 3-(4-Biphenyl)propionic acid, 95%, 3-(4-Biphenyl)propionic acid, 98% , 3-(4-Biphenyl)propionic acid, 97%, 3-(4-Biphenyl)propionic Acid, >95% (HPLC), 3–((1,1'–Biphenyl)–4–yl)propanoic acid. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Fluorochem, TRC, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg, 2.5g, 10g, 25g.
3-(4-phenylphenyl)propanoic acid (CAS 35888-99-4) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 3-(4-phenylphenyl)propanoic acid. InChIKey: MVFHRQWYCXYYMU-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3-(4-phenylphenyl)propanoic acid |
| InChIKey | MVFHRQWYCXYYMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CCC(=O)O |
Computed by PubChem (NCBI)