CAS 35891-87-3 appears in our catalog under these names: Lidocaine Impurity 7(Lidocaine EP Impurity G), 2-(Isopropylamino)-2',6'-acetoxylidide Hydrochloride, >95% (HPLC), N-(2,6-Dimethylphenyl)-2-((1-methylethyl)amino)acetamide Hydrochloride, 2-(Isopropylamino)-2',6'-acetoxylidide hydrochloride. Offered by: Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 10g, 1g, 4x25mg.
N-(2,6-dimethylphenyl)-2-(propan-2-ylamino)acetamide;hydrochloride (CAS 35891-87-3) is a chemical compound with the molecular formula C13H21ClN2O and a molecular weight of 256.77 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-(propan-2-ylamino)acetamide;hydrochloride. InChIKey: RBARWVLIAWVSHV-UHFFFAOYSA-N.
| Molecular formula | C13H21ClN2O |
|---|---|
| Molecular weight | 256.77 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-(propan-2-ylamino)acetamide;hydrochloride |
| InChIKey | RBARWVLIAWVSHV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CNC(C)C.Cl |
Computed by PubChem (NCBI)