CAS 77470-96-3 is the registry number for 4-Amino-N-(2,6-dimethylphenyl)pentanamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-N-(2,6-dimethylphenyl)pentanamide;hydrochloride (CAS 77470-96-3) is a chemical compound with the molecular formula C13H21ClN2O and a molecular weight of 256.77 g/mol. IUPAC name: 4-amino-N-(2,6-dimethylphenyl)pentanamide;hydrochloride. InChIKey: MPIQKCMNTBHCEP-UHFFFAOYSA-N.
| Molecular formula | C13H21ClN2O |
|---|---|
| Molecular weight | 256.77 g/mol |
| IUPAC name | 4-amino-N-(2,6-dimethylphenyl)pentanamide;hydrochloride |
| InChIKey | MPIQKCMNTBHCEP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CCC(C)N.Cl |
Computed by PubChem (NCBI)